CAS 66955-75-7 appears in our catalog under these names: 4–Amino–3–bromophenylacetic acid, (4-Amino-3-bromophenyl)acetic acid 95%, 4-Amino-3-bromophenylacetic acid, 95%, 95%, 2-(4-AMINO-3-BROMOPHENYL)ACETIC ACID, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-(4-amino-3-bromophenyl)acetic acid (CAS 66955-75-7) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-(4-amino-3-bromophenyl)acetic acid. InChIKey: LGUKTYAEODCQMW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-(4-amino-3-bromophenyl)acetic acid |
| InChIKey | LGUKTYAEODCQMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)Br)N |
Computed by PubChem (NCBI)