CAS 66959-86-2 is the registry number for Boc-N-Me-Met-OH, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid (CAS 66959-86-2) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: FLASRJKXDLPTOJ-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4S |
|---|---|
| Molecular weight | 263.36 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | FLASRJKXDLPTOJ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](CCSC)C(=O)O |
Computed by PubChem (NCBI)