Products 66959-86-2

CAS 66959-86-2 is the registry number for Boc-N-Me-Met-OH, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid (CAS 66959-86-2) is a chemical compound with the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: FLASRJKXDLPTOJ-QMMMGPOBSA-N.

Identity
Molecular formulaC11H21NO4S
Molecular weight263.36 g/mol
IUPAC name(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-methylsulfanylbutanoic acid
InChIKeyFLASRJKXDLPTOJ-QMMMGPOBSA-N
SMILESCC(C)(C)OC(=O)N(C)[C@@H](CCSC)C(=O)O

Computed by PubChem (NCBI)