CAS 669713-66-0 appears in our catalog under these names: N-Benzyloxymethyl-4-nitroimidazole, 95%, 1-((Benzyloxy)methyl)-4-nitro-1H-imidazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-nitro-1-(phenylmethoxymethyl)imidazole (CAS 669713-66-0) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 4-nitro-1-(phenylmethoxymethyl)imidazole. InChIKey: TXXYYOUBDOAQDT-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 4-nitro-1-(phenylmethoxymethyl)imidazole |
| InChIKey | TXXYYOUBDOAQDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCN2C=C(N=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)