Products 670266-31-6
CAS 670266-31-6 appears in our catalog under these names: Sulpiride Impurity 30, Sulpiride Impurity 11. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxy-5-[(2,4,6-trimethylphenyl)sulfamoyl]benzoic acid (CAS 670266-31-6) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: 2-hydroxy-5-[(2,4,6-trimethylphenyl)sulfamoyl]benzoic acid. InChIKey: ZQZPCVVQKXBEIQ-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 2-hydroxy-5-[(2,4,6-trimethylphenyl)sulfamoyl]benzoic acid |
| InChIKey | ZQZPCVVQKXBEIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O)C |
Computed by PubChem (NCBI)