CAS 671-89-6 appears in our catalog under these names: 4-Amino-6-chloro-1,3-benzenedisulfonyl Dichloride, 4-Amino-6-chloro-benzene-1,3-disulfonyl dichloride, 95%, Hydrochlorothiazide Impurity 20, Hydrochlorothiazide Impurity 14. Offered by: TRC, Combi-blocks, Chemat Brand. Available pack sizes: 1g, 250mg, 5g, 10g, on request.
4-amino-6-chlorobenzene-1,3-disulfonyl chloride (CAS 671-89-6) is a chemical compound with the molecular formula C6H4Cl3NO4S2 and a molecular weight of 324.6 g/mol. IUPAC name: 4-amino-6-chlorobenzene-1,3-disulfonyl chloride. InChIKey: YIZXGHNDQUYDDF-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO4S2 |
|---|---|
| Molecular weight | 324.6 g/mol |
| IUPAC name | 4-amino-6-chlorobenzene-1,3-disulfonyl chloride |
| InChIKey | YIZXGHNDQUYDDF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)Cl)S(=O)(=O)Cl)N |
Computed by PubChem (NCBI)