Products 89487-74-1
CAS 89487-74-1 is the registry number for Hydrochlorothiazide Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-chlorobenzene-1,4-disulfonyl chloride (CAS 89487-74-1) is a chemical compound with the molecular formula C6H4Cl3NO4S2 and a molecular weight of 324.6 g/mol. IUPAC name: 2-amino-5-chlorobenzene-1,4-disulfonyl chloride. InChIKey: HMXFVSHKRGAWON-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO4S2 |
|---|---|
| Molecular weight | 324.6 g/mol |
| IUPAC name | 2-amino-5-chlorobenzene-1,4-disulfonyl chloride |
| InChIKey | HMXFVSHKRGAWON-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)Cl)S(=O)(=O)Cl)N |
Computed by PubChem (NCBI)