Products 89598-89-0

CAS 89598-89-0 is the registry number for Hydrochlorothiazide Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-amino-5-chlorobenzene-1,3-disulfonyl chloride (CAS 89598-89-0) is a chemical compound with the molecular formula C6H4Cl3NO4S2 and a molecular weight of 324.6 g/mol. IUPAC name: 2-amino-5-chlorobenzene-1,3-disulfonyl chloride. InChIKey: IZLZMDCAOZWGSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Cl3NO4S2
Molecular weight324.6 g/mol
IUPAC name2-amino-5-chlorobenzene-1,3-disulfonyl chloride
InChIKeyIZLZMDCAOZWGSJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1S(=O)(=O)Cl)N)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)