Products 672-73-1
CAS 672-73-1 appears in our catalog under these names: Adrenalinequinone, Adrenaline Impurity 28. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(3,4-dihydroxyphenyl)-N-formyl-2-hydroxyacetamide (CAS 672-73-1) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-N-formyl-2-hydroxyacetamide. InChIKey: QPEAHUBYIJFRHS-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-N-formyl-2-hydroxyacetamide |
| InChIKey | QPEAHUBYIJFRHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)NC=O)O)O)O |
Computed by PubChem (NCBI)