CAS 67267-08-7 appears in our catalog under these names: Ethyl 5-oxo-1-phenyl-4,5-dihydro-1H-1,2,4-triazole-3-carboxylate, 98%, 98%, ethyl 5-oxo-1-phenyl-4,5-dihydro-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 5-oxo-1-phenyl-4H-1,2,4-triazole-3-carboxylate (CAS 67267-08-7) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: ethyl 5-oxo-1-phenyl-4H-1,2,4-triazole-3-carboxylate. InChIKey: DFWQCUMZCKRJKD-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | ethyl 5-oxo-1-phenyl-4H-1,2,4-triazole-3-carboxylate |
| InChIKey | DFWQCUMZCKRJKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=O)N1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)