Products 67303-48-4
CAS 67303-48-4 appears in our catalog under these names: 2-Amino-6-bromo-3-methoxybenzoic acid, 95%, 2-AMINO-6-BROMO-3-METHOXYBENZOIC ACID, >95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-amino-6-bromo-3-methoxybenzoic acid (CAS 67303-48-4) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-amino-6-bromo-3-methoxybenzoic acid. InChIKey: HMCXJHVLOBBQJV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-amino-6-bromo-3-methoxybenzoic acid |
| InChIKey | HMCXJHVLOBBQJV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)O)N |
Computed by PubChem (NCBI)