Products 67381-50-4
CAS 67381-50-4 appears in our catalog under these names: Loxoprofen Impurity 4, 4-(1-Carboxyethyl)benzoic Acid, 4–Carboxy–α–methylbenzeneacetic Acid, 4-(1-carboxyethyl)benzoic acid, 95%, 4-Carboxy-a-methylbenzeneacetic Acid, >95% (HPLC). Offered by: Chemat Brand, Mikromol, GLPBio, Fluorochem, TRC. Available pack sizes: on request, 25mg, 100mg, 250mg, 50mg, 5mg, 1g.
4-(1-carboxyethyl)benzoic acid (CAS 67381-50-4) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 4-(1-carboxyethyl)benzoic acid. InChIKey: ZHJJCJKDNFTHKD-UHFFFAOYSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | 4-(1-carboxyethyl)benzoic acid |
| InChIKey | ZHJJCJKDNFTHKD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)