CAS 67452-85-1 appears in our catalog under these names: 1-Benzoyl-3-piperidinone, 1-Benzoylpiperidin-3-one, 98+%, 1-Benzoyl-piperidin-3-one, 95%. Offered by: TRC, AmBeed, Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
1-benzoylpiperidin-3-one (CAS 67452-85-1) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 1-benzoylpiperidin-3-one. InChIKey: SBQPFUPQROCYRR-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 1-benzoylpiperidin-3-one |
| InChIKey | SBQPFUPQROCYRR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)