CAS 67468-59-1 is the registry number for 4-(1,2-Dimethylpropyl)benzaldehyde. Offered by: TRC. Available pack sizes: 250mg.
4-(3-methylbutan-2-yl)benzaldehyde (CAS 67468-59-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 4-(3-methylbutan-2-yl)benzaldehyde. InChIKey: ASCPGKMHGGQVAW-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 4-(3-methylbutan-2-yl)benzaldehyde |
| InChIKey | ASCPGKMHGGQVAW-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)