CAS 674810-96-9 appears in our catalog under these names: 4-(4-Methoxyphenyl)pyrimidin-2-ol, 95%, 4–(4–Methoxyphenyl)pyrimidin–2–ol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
6-(4-methoxyphenyl)-1H-pyrimidin-2-one (CAS 674810-96-9) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 6-(4-methoxyphenyl)-1H-pyrimidin-2-one. InChIKey: HRLRMYOMZYYDCE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)-1H-pyrimidin-2-one |
| InChIKey | HRLRMYOMZYYDCE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=NC(=O)N2 |
Computed by PubChem (NCBI)