CAS 67482-20-6 appears in our catalog under these names: 2,2-Diethyl-2H-1,3-benzodioxol-5-amine, 95%, 2,2-Diethyl-1,3-dioxaindan-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2-diethyl-1,3-benzodioxol-5-amine (CAS 67482-20-6) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2,2-diethyl-1,3-benzodioxol-5-amine. InChIKey: ASRKBBBOOGTIHA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2,2-diethyl-1,3-benzodioxol-5-amine |
| InChIKey | ASRKBBBOOGTIHA-UHFFFAOYSA-N |
| SMILES | CCC1(OC2=C(O1)C=C(C=C2)N)CC |
Computed by PubChem (NCBI)