Products 675126-07-5
CAS 675126-07-5 appears in our catalog under these names: (1S,4R)-N-Desmethyl Sertraline Hydrochloride, (1S,4R)-N-Desmethyl Sertraline Hydrochloride/ 99.71% (existing batch purity). Offered by: TRC, TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(1S,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 675126-07-5) is a chemical compound with the molecular formula C16H16Cl3N and a molecular weight of 328.7 g/mol. IUPAC name: (1S,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: YKXHIERZIRLOLD-VAGBGMFXSA-N.
| Molecular formula | C16H16Cl3N |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | (1S,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | YKXHIERZIRLOLD-VAGBGMFXSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2[C@H]1C3=CC(=C(C=C3)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)