CAS 675126-10-0 appears in our catalog under these names: Desmethyl Sertraline HCl, (1S,4S)-N-Desmethyl Sertraline Hydrochloride, >95% (HPLC), (1S,4S)-N-Desmethyl Sertraline (hydrochloride). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 675126-10-0) is a chemical compound with the molecular formula C16H16Cl3N and a molecular weight of 328.7 g/mol. IUPAC name: (1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: YKXHIERZIRLOLD-RISSCEEYSA-N.
| Molecular formula | C16H16Cl3N |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | (1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | YKXHIERZIRLOLD-RISSCEEYSA-N |
| SMILES | C1C[C@@H](C2=CC=CC=C2[C@@H]1C3=CC(=C(C=C3)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)