CAS 675126-09-7 appears in our catalog under these names: (1R,4R)-N-Desmethyl Sertraline Hydrochloride, >95% (HPLC), N–desmethyl Sertraline (hydrochloride), (1R,4R)-4-(3,4-Dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 500 μg, 1 mg.
(1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 675126-09-7) is a chemical compound with the molecular formula C16H16Cl3N and a molecular weight of 328.7 g/mol. IUPAC name: (1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: YKXHIERZIRLOLD-INXKOZGQSA-N.
| Molecular formula | C16H16Cl3N |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | (1R,4R)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | YKXHIERZIRLOLD-INXKOZGQSA-N |
| SMILES | C1C[C@H](C2=CC=CC=C2[C@H]1C3=CC(=C(C=C3)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)