Products 675578-40-2
CAS 675578-40-2 is the registry number for Methyl 5-methoxy-2-((4-methylphenyl)sulfonamido)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-methoxy-2-[(4-methylphenyl)sulfonylamino]benzoate (CAS 675578-40-2) is a chemical compound with the molecular formula C16H17NO5S and a molecular weight of 335.4 g/mol. IUPAC name: methyl 5-methoxy-2-[(4-methylphenyl)sulfonylamino]benzoate. InChIKey: XUYYQEONOHIXEH-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5S |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | methyl 5-methoxy-2-[(4-methylphenyl)sulfonylamino]benzoate |
| InChIKey | XUYYQEONOHIXEH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=C(C=C(C=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)