Products 67567-46-8
CAS 67567-46-8 appears in our catalog under these names: 2-(Bromomethyl)-4-methoxy-1-nitrobenzene, 2-(Bromomethyl)-4-methoxy-1-nitrobenzene 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-(bromomethyl)-4-methoxy-1-nitrobenzene (CAS 67567-46-8) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 2-(bromomethyl)-4-methoxy-1-nitrobenzene. InChIKey: BXVAGOCCUQNTFR-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 2-(bromomethyl)-4-methoxy-1-nitrobenzene |
| InChIKey | BXVAGOCCUQNTFR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)