Products 67597-67-5
CAS 67597-67-5 is the registry number for (2S)-2-Amino-4-methyl-1-(morpholin-4-yl)pentan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-2-amino-4-methyl-1-morpholin-4-ylpentan-1-one;hydrochloride (CAS 67597-67-5) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: (2S)-2-amino-4-methyl-1-morpholin-4-ylpentan-1-one;hydrochloride. InChIKey: WRSDWRRFBJHELY-FVGYRXGTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | (2S)-2-amino-4-methyl-1-morpholin-4-ylpentan-1-one;hydrochloride |
| InChIKey | WRSDWRRFBJHELY-FVGYRXGTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N1CCOCC1)N.Cl |
Computed by PubChem (NCBI)