Products 676116-21-5
CAS 676116-21-5 appears in our catalog under these names: 8-Chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one, 98%, 8-Chloro-4,4-dimethyl-3,4-dihydroquinolin-2(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
8-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one (CAS 676116-21-5) is a chemical compound with the molecular formula C11H12ClNO and a molecular weight of 209.67 g/mol. IUPAC name: 8-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one. InChIKey: DKDXVAZEBXCVKQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 8-chloro-4,4-dimethyl-1,3-dihydroquinolin-2-one |
| InChIKey | DKDXVAZEBXCVKQ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC2=C1C=CC=C2Cl)C |
Computed by PubChem (NCBI)