CAS 67643-46-3 is the registry number for 6-Bromo-4-hydroxy-8-methylquinoline-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 67643-46-3) is a chemical compound with the molecular formula C11H8BrNO3 and a molecular weight of 282.09 g/mol. IUPAC name: 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: QQAKWUOQYYHCSK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrNO3 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 6-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | QQAKWUOQYYHCSK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC=C(C2=O)C(=O)O)Br |
Computed by PubChem (NCBI)