Products 677294-33-6
CAS 677294-33-6 is the registry number for N-(5-Iodo-6-methylpyridin-2-yl)propionamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-iodo-6-methyl-2-pyridinyl)propanamide (CAS 677294-33-6) is a chemical compound with the molecular formula C9H11IN2O and a molecular weight of 290.10 g/mol. IUPAC name: N-(5-iodo-6-methyl-2-pyridinyl)propanamide. InChIKey: QBAWKWDCNCEUHQ-UHFFFAOYSA-N.
| Molecular formula | C9H11IN2O |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | N-(5-iodo-6-methyl-2-pyridinyl)propanamide |
| InChIKey | QBAWKWDCNCEUHQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=NC(=C(C=C1)I)C |
Computed by PubChem (NCBI)