CAS 92317-98-1 appears in our catalog under these names: 3-(4-Iodophenyl)-1,1-dimethylurea, 98%, 3-(4-Iodophenyl)-1,1-dimethylurea, 95-<97%. Offered by: Chemat Brand, Hoffman Fine Chemicals. Available pack sizes: on request, 10g, 25g, 50g.
3-(4-iodophenyl)-1,1-dimethylurea (CAS 92317-98-1) is a chemical compound with the molecular formula C9H11IN2O and a molecular weight of 290.10 g/mol. IUPAC name: 3-(4-iodophenyl)-1,1-dimethylurea. InChIKey: QXWBCYDYAGDZBL-UHFFFAOYSA-N.
| Molecular formula | C9H11IN2O |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | 3-(4-iodophenyl)-1,1-dimethylurea |
| InChIKey | QXWBCYDYAGDZBL-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC=C(C=C1)I |
Computed by PubChem (NCBI)