CAS 960067-72-5 is the registry number for 2-Amino-5-iodo-N,N-dimethylbenzamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-5-iodo-N,N-dimethylbenzamide (CAS 960067-72-5) is a chemical compound with the molecular formula C9H11IN2O and a molecular weight of 290.10 g/mol. IUPAC name: 2-amino-5-iodo-N,N-dimethylbenzamide. InChIKey: HCLJKDNUPSLZLG-UHFFFAOYSA-N.
| Molecular formula | C9H11IN2O |
|---|---|
| Molecular weight | 290.10 g/mol |
| IUPAC name | 2-amino-5-iodo-N,N-dimethylbenzamide |
| InChIKey | HCLJKDNUPSLZLG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC(=C1)I)N |
Computed by PubChem (NCBI)