CAS 677306-38-6 appears in our catalog under these names: 1H–indazole–4–carboxylic acid, 1H-Indazole-4-carboxylic acid, 97%, 1H-Indazole-4-carboxylic acid, 97%, 97%, 1H-Indazole-4-carboxylic acid, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100g.
1H-indazole-4-carboxylic acid (CAS 677306-38-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-4-carboxylic acid. InChIKey: KGKZHHIUOZGUNP-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-4-carboxylic acid |
| InChIKey | KGKZHHIUOZGUNP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NNC2=C1)C(=O)O |
Computed by PubChem (NCBI)