CAS 67804-53-9 appears in our catalog under these names: N-(3-Aminophenyl)-1,3-propanesultam, 95%, 2-(3-Aminophenyl)isothiazolidine 1,1-dioxide, 95+%, 3-(1,1-Dioxo-1lambda(6)-isothiazolidin-2-yl)-phenylamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 100mg, 5g, 250mg, 2g, 25g.
3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline (CAS 67804-53-9) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline. InChIKey: MACVOXCGYYWJRP-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)aniline |
| InChIKey | MACVOXCGYYWJRP-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)