CAS 67851-29-0 is the registry number for 2-Methoxy-4-nitrophenyl acetate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methoxy-4-nitrophenyl) acetate (CAS 67851-29-0) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: (2-methoxy-4-nitrophenyl) acetate. InChIKey: DIKOVRNHZKVROR-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | (2-methoxy-4-nitrophenyl) acetate |
| InChIKey | DIKOVRNHZKVROR-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)