CAS 67896-55-3 appears in our catalog under these names: Norepinephrine Impurity 20 (Noradrenalinequinone), Noradrenaline (Norepinephrine) Impurity 7, Norepinephrine Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[(1R)-2-amino-1-hydroxyethyl]cyclohexa-3,5-diene-1,2-dione (CAS 67896-55-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 4-[(1R)-2-amino-1-hydroxyethyl]cyclohexa-3,5-diene-1,2-dione. InChIKey: WCHGCMBSJBGAKH-QMMMGPOBSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 4-[(1R)-2-amino-1-hydroxyethyl]cyclohexa-3,5-diene-1,2-dione |
| InChIKey | WCHGCMBSJBGAKH-QMMMGPOBSA-N |
| SMILES | C1=CC(=O)C(=O)C=C1[C@H](CN)O |
Computed by PubChem (NCBI)