CAS 67919-80-6 is the registry number for Boc-L-Ala-CHN2. Offered by: Creative Peptides. Available pack sizes: 1g.
Tert-butyl N-[(2S)-4-diazo-3-oxobutan-2-yl]carbamate (CAS 67919-80-6) is a chemical compound with the molecular formula C9H15N3O3 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl N-[(2S)-4-diazo-3-oxobutan-2-yl]carbamate. InChIKey: XPHQCGACMYIDJE-LURJTMIESA-N.
| Molecular formula | C9H15N3O3 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-diazo-3-oxobutan-2-yl]carbamate |
| InChIKey | XPHQCGACMYIDJE-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)C=[N+]=[N-])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)