Products 7013-09-4
CAS 7013-09-4 is the registry number for Diazoacetyl–DL–Nle–OMe. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl 2-[(2-diazoacetyl)amino]hexanoate (CAS 7013-09-4) is a chemical compound with the molecular formula C9H15N3O3 and a molecular weight of 213.23 g/mol. IUPAC name: methyl 2-[(2-diazoacetyl)amino]hexanoate. InChIKey: GZUCPCIYJMTPIU-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O3 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | methyl 2-[(2-diazoacetyl)amino]hexanoate |
| InChIKey | GZUCPCIYJMTPIU-UHFFFAOYSA-N |
| SMILES | CCCCC(C(=O)OC)NC(=O)C=[N+]=[N-] |
Computed by PubChem (NCBI)