CAS 716329-44-1 is the registry number for (R)-tert-Butyl (1-(1,3,4-oxadiazol-2-yl)ethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1R)-1-(1,3,4-oxadiazol-2-yl)ethyl]carbamate (CAS 716329-44-1) is a chemical compound with the molecular formula C9H15N3O3 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl N-[(1R)-1-(1,3,4-oxadiazol-2-yl)ethyl]carbamate. InChIKey: LUQVTKJYPIONEO-ZCFIWIBFSA-N.
| Molecular formula | C9H15N3O3 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl N-[(1R)-1-(1,3,4-oxadiazol-2-yl)ethyl]carbamate |
| InChIKey | LUQVTKJYPIONEO-ZCFIWIBFSA-N |
| SMILES | C[C@H](C1=NN=CO1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)