CAS 67947-42-6 is the registry number for 4,5-Bis(thiophen-2-yl)-1H-imidazole-2-thiol. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4,5-dithiophen-2-yl-1,3-dihydroimidazole-2-thione (CAS 67947-42-6) is a chemical compound with the molecular formula C11H8N2S3 and a molecular weight of 264.4 g/mol. IUPAC name: 4,5-dithiophen-2-yl-1,3-dihydroimidazole-2-thione. InChIKey: ODBUBIMVCRYBKS-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S3 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 4,5-dithiophen-2-yl-1,3-dihydroimidazole-2-thione |
| InChIKey | ODBUBIMVCRYBKS-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(NC(=S)N2)C3=CC=CS3 |
Computed by PubChem (NCBI)