CAS 721415-79-8 appears in our catalog under these names: Bis(thiophen-2-yl)-1,3-thiazol-2-amine, 95%, Bis(thiophen-2-yl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4,5-dithiophen-2-yl-1,3-thiazol-2-amine (CAS 721415-79-8) is a chemical compound with the molecular formula C11H8N2S3 and a molecular weight of 264.4 g/mol. IUPAC name: 4,5-dithiophen-2-yl-1,3-thiazol-2-amine. InChIKey: LTSOKEYTZZBDFR-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S3 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 4,5-dithiophen-2-yl-1,3-thiazol-2-amine |
| InChIKey | LTSOKEYTZZBDFR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(SC(=N2)N)C3=CC=CS3 |
Computed by PubChem (NCBI)