CAS 732292-19-2 is the registry number for 2-Methyl-5-(thiophen-2-yl)thieno(2,3-d)pyrimidine-4-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidine-4-thione (CAS 732292-19-2) is a chemical compound with the molecular formula C11H8N2S3 and a molecular weight of 264.4 g/mol. IUPAC name: 2-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidine-4-thione. InChIKey: RXHAWENUDTUMBB-UHFFFAOYSA-N.
| Molecular formula | C11H8N2S3 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 2-methyl-5-thiophen-2-yl-3H-thieno[2,3-d]pyrimidine-4-thione |
| InChIKey | RXHAWENUDTUMBB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CS2)C3=CC=CS3)C(=S)N1 |
Computed by PubChem (NCBI)