CAS 67975-14-8 appears in our catalog under these names: 2-(4-(1,3-Benzothiazol-2-yl)phenoxy)propanoic acid, 95%, 2-(4-(1,3-Benzothiazol-2-yl)phenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[4-(1,3-benzothiazol-2-yl)phenoxy]propanoic acid (CAS 67975-14-8) is a chemical compound with the molecular formula C16H13NO3S and a molecular weight of 299.3 g/mol. IUPAC name: 2-[4-(1,3-benzothiazol-2-yl)phenoxy]propanoic acid. InChIKey: MWPVGPUGWCAROK-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 2-[4-(1,3-benzothiazol-2-yl)phenoxy]propanoic acid |
| InChIKey | MWPVGPUGWCAROK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC=C(C=C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)