CAS 688760-44-3 is the registry number for 4-Benzyl-3-oxo-3,4-dihydro-2h-1,4-benzothiazine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-benzyl-3-oxo-1,4-benzothiazine-6-carboxylic acid (CAS 688760-44-3) is a chemical compound with the molecular formula C16H13NO3S and a molecular weight of 299.3 g/mol. IUPAC name: 4-benzyl-3-oxo-1,4-benzothiazine-6-carboxylic acid. InChIKey: RZXDYYAPSRQTTG-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 4-benzyl-3-oxo-1,4-benzothiazine-6-carboxylic acid |
| InChIKey | RZXDYYAPSRQTTG-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(S1)C=CC(=C2)C(=O)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)