CAS 50562-79-3 appears in our catalog under these names: 1-Tosyl-1H-indole-3-carbaldehyde 98%, 1-Tosyl-1H-indole-3-carbaldehyde, 98%, 98%, 1-(Toluene-4-sulfonyl)-1 H -indole-3-carbaldehyde, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-(4-methylphenyl)sulfonylindole-3-carbaldehyde (CAS 50562-79-3) is a chemical compound with the molecular formula C16H13NO3S and a molecular weight of 299.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylindole-3-carbaldehyde. InChIKey: OIPHRFQIBIQGJF-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylindole-3-carbaldehyde |
| InChIKey | OIPHRFQIBIQGJF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=CC=CC=C32)C=O |
Computed by PubChem (NCBI)