CAS 1532-82-7 is the registry number for 4-(4-Methylbenzenesulfonate)-4-isoquinolinol. Offered by: Biosynth. Available pack sizes: 1000mg, 100mg, 250mg, 500mg.
Isoquinolin-4-yl 4-methylbenzenesulfonate (CAS 1532-82-7) is a chemical compound with the molecular formula C16H13NO3S and a molecular weight of 299.3 g/mol. IUPAC name: isoquinolin-4-yl 4-methylbenzenesulfonate. InChIKey: YZERKZTZGUTSFJ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO3S |
|---|---|
| Molecular weight | 299.3 g/mol |
| IUPAC name | isoquinolin-4-yl 4-methylbenzenesulfonate |
| InChIKey | YZERKZTZGUTSFJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CN=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)