Products 67978-85-2
CAS 67978-85-2 is the registry number for Piscerygenin. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromen-4-one (CAS 67978-85-2) is a chemical compound with the molecular formula C16H12O7 and a molecular weight of 316.26 g/mol. IUPAC name: 3-(2,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromen-4-one. InChIKey: OEWYVOHIQUVAAO-UHFFFAOYSA-N.
| Molecular formula | C16H12O7 |
|---|---|
| Molecular weight | 316.26 g/mol |
| IUPAC name | 3-(2,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxychromen-4-one |
| InChIKey | OEWYVOHIQUVAAO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C2=COC3=CC(=CC(=C3C2=O)O)O)O)O |
Computed by PubChem (NCBI)