Products 679835-70-2
CAS 679835-70-2 is the registry number for 2'-Amino-[1,1':3',1''-terphenyl]-4,4''-dicarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-amino-3-(4-formylphenyl)phenyl]benzaldehyde (CAS 679835-70-2) is a chemical compound with the molecular formula C20H15NO2 and a molecular weight of 301.3 g/mol. IUPAC name: 4-[2-amino-3-(4-formylphenyl)phenyl]benzaldehyde. InChIKey: OYHGPQMEKIRHOU-UHFFFAOYSA-N.
| Molecular formula | C20H15NO2 |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 4-[2-amino-3-(4-formylphenyl)phenyl]benzaldehyde |
| InChIKey | OYHGPQMEKIRHOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C2=CC=C(C=C2)C=O)N)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)