CAS 53566-95-3 appears in our catalog under these names: 4,4'-DIFORMYLTRIPHENYLAMINE, 95%, 4,4'-(Phenylazanediyl)dibenzaldehyde 95%, 4,4′–Diformyltriphenylamine, Bis(4-formylphenyl)phenylamine, >95.0%(GC), 4,4′-Diformyltriphenylamine, 96%, 96%. Offered by: Sigma-Aldrich, Ambeed, GLPBio, TCI, Chemat. Available pack sizes: 1G, 250mg, 5g, 25g, 100mg, 10g.
4-(N-(4-formylphenyl)anilino)benzaldehyde (CAS 53566-95-3) is a chemical compound with the molecular formula C20H15NO2 and a molecular weight of 301.3 g/mol. IUPAC name: 4-(N-(4-formylphenyl)anilino)benzaldehyde. InChIKey: DOUAFMIJGIUWJX-UHFFFAOYSA-N.
| Molecular formula | C20H15NO2 |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 4-(N-(4-formylphenyl)anilino)benzaldehyde |
| InChIKey | DOUAFMIJGIUWJX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C=O)C3=CC=C(C=C3)C=O |
Computed by PubChem (NCBI)