Products 29670-64-2

CAS 29670-64-2 is the registry number for 2-Benzamidobenzophenone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

N-(2-benzoylphenyl)benzamide (CAS 29670-64-2) is a chemical compound with the molecular formula C20H15NO2 and a molecular weight of 301.3 g/mol. IUPAC name: N-(2-benzoylphenyl)benzamide. InChIKey: HMCZRNIZFJNCEY-UHFFFAOYSA-N.

Identity
Molecular formulaC20H15NO2
Molecular weight301.3 g/mol
IUPAC nameN-(2-benzoylphenyl)benzamide
InChIKeyHMCZRNIZFJNCEY-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C2=CC=CC=C2NC(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)