Products 878475-30-0
CAS 878475-30-0 appears in our catalog under these names: Isosalviamine B, Isosalviamine B. Offered by: GLPBio, Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene (CAS 878475-30-0) is a chemical compound with the molecular formula C20H15NO2 and a molecular weight of 301.3 g/mol. IUPAC name: 5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene. InChIKey: IVRVVMSJCWUYKG-UHFFFAOYSA-N.
| Molecular formula | C20H15NO2 |
|---|---|
| Molecular weight | 301.3 g/mol |
| IUPAC name | 5,9,17-trimethyl-3,8-dioxa-10-azapentacyclo[10.8.0.02,6.07,11.013,18]icosa-1(12),2(6),4,7(11),9,13,15,17,19-nonaene |
| InChIKey | IVRVVMSJCWUYKG-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C4=C(C5=C3OC=C5C)OC(=N4)C |
Computed by PubChem (NCBI)
Synonyms:
Isosalviamine B, orb1992549