CAS 679840-30-3 appears in our catalog under these names: 2-(5-Bromo-2-fluorophenyl)-1,3-dioxolane, 95+%, 2-(5-Bromo-2-fluorophenyl)-1,3-dioxolane, 95%, 95%, 2-(5-Bromo-2-fluorophenyl)-1,3-dioxolane, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 200mg, 1g, 100mg, 250mg.
2-(5-bromo-2-fluorophenyl)-1,3-dioxolane (CAS 679840-30-3) is a chemical compound with the molecular formula C9H8BrFO2 and a molecular weight of 247.06 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)-1,3-dioxolane. InChIKey: WWJNPWYIXIIEJG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO2 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)-1,3-dioxolane |
| InChIKey | WWJNPWYIXIIEJG-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)