CAS 926253-82-9 is the registry number for 1-(2,4-Dichlorophenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2,4-dichlorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 926253-82-9) is a chemical compound with the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.13 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: QQGLPZJTZFWPDK-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O2 |
|---|---|
| Molecular weight | 297.13 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | QQGLPZJTZFWPDK-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)