CAS 68097-15-4 is the registry number for 3,4'-Diacetyldiphenyl Oxide. Offered by: TRC. Available pack sizes: 500mg.
1-[4-(3-acetylphenoxy)phenyl]ethanone (CAS 68097-15-4) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: 1-[4-(3-acetylphenoxy)phenyl]ethanone. InChIKey: AQDALYHAKAMTMR-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 1-[4-(3-acetylphenoxy)phenyl]ethanone |
| InChIKey | AQDALYHAKAMTMR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)C |
Computed by PubChem (NCBI)