Products 681002-67-5
CAS 681002-67-5 is the registry number for GW632046X. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-methylphenyl)-5-phenyl-1,3-oxazol-2-amine (CAS 681002-67-5) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: N-(3-methylphenyl)-5-phenyl-1,3-oxazol-2-amine. InChIKey: XLGKHWGSIZWZNN-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | N-(3-methylphenyl)-5-phenyl-1,3-oxazol-2-amine |
| InChIKey | XLGKHWGSIZWZNN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NC=C(O2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)