Products 681034-84-4
CAS 681034-84-4 is the registry number for ethyl 5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ethyl 5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate (CAS 681034-84-4) is a chemical compound with the molecular formula C8H10F2N2O2 and a molecular weight of 204.17 g/mol. IUPAC name: ethyl 5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate. InChIKey: IZBVWWIIJNKCIU-UHFFFAOYSA-N.
| Molecular formula | C8H10F2N2O2 |
|---|---|
| Molecular weight | 204.17 g/mol |
| IUPAC name | ethyl 5-(1,1-difluoroethyl)-1H-pyrazole-3-carboxylate |
| InChIKey | IZBVWWIIJNKCIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NNC(=C1)C(C)(F)F |
Computed by PubChem (NCBI)